* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5867985 |
| English Synonyms: | ABAMACHEM ABA-5867985 |
| MDL Number.: | MFCD18007294 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | CC(CNc1cc2ccccc2c(=O)[nH]1)C(=O)O |
| InChi: | InChI=1S/C13H14N2O3/c1-8(13(17)18)7-14-11-6-9-4-2-3-5-10(9)12(16)15-11/h2-6,8H,7H2,1H3,(H,17,18)(H2,14,15,16) |
| InChiKey: | InChIKey=LWIPAXHOQIYIJM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.