* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5868179 |
English Synonyms: | ABAMACHEM ABA-5868179 |
MDL Number.: | MFCD18007487 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CC(CN)C(=O)Nc1cccc(c1)c2nnnn2C |
InChi: | InChI=1S/C12H16N6O/c1-8(7-13)12(19)14-10-5-3-4-9(6-10)11-15-16-17-18(11)2/h3-6,8H,7,13H2,1-2H3,(H,14,19) |
InChiKey: | InChIKey=MBQOIUQRCFSPBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.