* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABAMACHEM ABA-5868744 |
English Synonyms: | ABAMACHEM ABA-5868744 |
MDL Number.: | MFCD18008027 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC(c1cc[nH]n1)NC(C)c2[nH]c3ccccc3n2 |
InChi: | InChI=1S/C14H17N5/c1-9(11-7-8-15-19-11)16-10(2)14-17-12-5-3-4-6-13(12)18-14/h3-10,16H,1-2H3,(H,15,19)(H,17,18) |
InChiKey: | InChIKey=JGKMNIWSTCUICL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.