* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABAMACHEM ABA-5868745 |
English Synonyms: | ABAMACHEM ABA-5868745 |
MDL Number.: | MFCD18008028 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCC(CC)CNC(C)c1[nH]c2ccccc2n1 |
InChi: | InChI=1S/C15H23N3/c1-4-12(5-2)10-16-11(3)15-17-13-8-6-7-9-14(13)18-15/h6-9,11-12,16H,4-5,10H2,1-3H3,(H,17,18) |
InChiKey: | InChIKey=OXONFCLVQWUKCV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.