* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5868748 |
English Synonyms: | ABAMACHEM ABA-5868748 |
MDL Number.: | MFCD18008031 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCCCC(C)NC(C)c1[nH]c2ccccc2n1 |
InChi: | InChI=1S/C16H25N3/c1-4-5-6-9-12(2)17-13(3)16-18-14-10-7-8-11-15(14)19-16/h7-8,10-13,17H,4-6,9H2,1-3H3,(H,18,19) |
InChiKey: | InChIKey=AUGWKJIKYXPFNU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.