* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABAMACHEM ABA-5869799 |
English Synonyms: | ABAMACHEM ABA-5869799 |
MDL Number.: | MFCD18009071 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | c1cc(c(cc1C(=O)NCCC(=O)N)N)[N+](=O)[O-] |
InChi: | InChI=1S/C10H12N4O4/c11-7-5-6(1-2-8(7)14(17)18)10(16)13-4-3-9(12)15/h1-2,5H,3-4,11H2,(H2,12,15)(H,13,16) |
InChiKey: | InChIKey=LZIHUOUIHHDNQZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.