* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5869809 |
English Synonyms: | ABAMACHEM ABA-5869809 |
MDL Number.: | MFCD18009081 |
H bond acceptor: | 10 |
H bond donor: | 3 |
Smile: | c1cc(c(cc1C(=O)NCc2[nH]nnn2)N)[N+](=O)[O-] |
InChi: | InChI=1S/C9H9N7O3/c10-6-3-5(1-2-7(6)16(18)19)9(17)11-4-8-12-14-15-13-8/h1-3H,4,10H2,(H,11,17)(H,12,13,14,15) |
InChiKey: | InChIKey=CDBJCZOYCRWOAW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.