* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5869842 |
English Synonyms: | ABAMACHEM ABA-5869842 |
MDL Number.: | MFCD18009113 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | CNC(=O)CNC(=O)c1ccc(c(c1)NN)[N+](=O)[O-] |
InChi: | InChI=1S/C10H13N5O4/c1-12-9(16)5-13-10(17)6-2-3-8(15(18)19)7(4-6)14-11/h2-4,14H,5,11H2,1H3,(H,12,16)(H,13,17) |
InChiKey: | InChIKey=ILRKEIQWXJCFIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.