* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5869970 |
| English Synonyms: | ABAMACHEM ABA-5869970 |
| MDL Number.: | MFCD18009232 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(C)n1c(ccn1)NC(=O)CN(C)CCN |
| InChi: | InChI=1S/C11H21N5O/c1-9(2)16-10(4-6-13-16)14-11(17)8-15(3)7-5-12/h4,6,9H,5,7-8,12H2,1-3H3,(H,14,17) |
| InChiKey: | InChIKey=NJYAWSQIMXPQKT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.