* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5870099 |
English Synonyms: | ABAMACHEM ABA-5870099 |
MDL Number.: | MFCD18009357 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CCN(CC)C(=O)CCNC(=O)c1c(non1)N |
InChi: | InChI=1S/C10H17N5O3/c1-3-15(4-2)7(16)5-6-12-10(17)8-9(11)14-18-13-8/h3-6H2,1-2H3,(H2,11,14)(H,12,17) |
InChiKey: | InChIKey=VBEXOSBGKPDRPQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.