* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5870249 |
| English Synonyms: | ABAMACHEM ABA-5870249 |
| MDL Number.: | MFCD18009503 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CN(C)CCn1c(cc(n1)c2ccc(cc2)Br)N |
| InChi: | InChI=1S/C13H17BrN4/c1-17(2)7-8-18-13(15)9-12(16-18)10-3-5-11(14)6-4-10/h3-6,9H,7-8,15H2,1-2H3 |
| InChiKey: | InChIKey=SGJNMGYDJSZXJN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.