* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5871072 |
English Synonyms: | ABAMACHEM ABA-5871072 |
MDL Number.: | MFCD18010306 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCC(C)CNCC(Cn1cc(cn1)[N+](=O)[O-])O |
InChi: | InChI=1S/C11H20N4O3/c1-3-9(2)4-12-6-11(16)8-14-7-10(5-13-14)15(17)18/h5,7,9,11-12,16H,3-4,6,8H2,1-2H3 |
InChiKey: | InChIKey=GBCRIDYFZROBCA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.