* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5871108 |
English Synonyms: | ABAMACHEM ABA-5871108 |
MDL Number.: | MFCD18010342 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CCC(C)CNC(=O)CNC(=O)c1ccc(cc1)N |
InChi: | InChI=1S/C14H21N3O2/c1-3-10(2)8-16-13(18)9-17-14(19)11-4-6-12(15)7-5-11/h4-7,10H,3,8-9,15H2,1-2H3,(H,16,18)(H,17,19) |
InChiKey: | InChIKey=CKLGZKASLWLFDV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.