* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5871349 |
English Synonyms: | ABAMACHEM ABA-5871349 |
MDL Number.: | MFCD18010573 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)n1cnnc1CCCNc2ccccc2 |
InChi: | InChI=1S/C14H20N4/c1-12(2)18-11-16-17-14(18)9-6-10-15-13-7-4-3-5-8-13/h3-5,7-8,11-12,15H,6,9-10H2,1-2H3 |
InChiKey: | InChIKey=WVZRQBJKQSEDAK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.