* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5871379 |
English Synonyms: | ABAMACHEM ABA-5871379 |
MDL Number.: | MFCD18010603 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCn1c(ncn1)c2ccc3c(c2)CCCN3 |
InChi: | InChI=1S/C13H16N4/c1-2-17-13(15-9-16-17)11-5-6-12-10(8-11)4-3-7-14-12/h5-6,8-9,14H,2-4,7H2,1H3 |
InChiKey: | InChIKey=CXVLOMZGPNGNHF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.