* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5871403 |
English Synonyms: | ABAMACHEM ABA-5871403 |
MDL Number.: | MFCD18010627 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | c1ccc2c(c1)c([nH]n2)C(=O)NC(C3CC3)C(=O)O |
InChi: | InChI=1S/C13H13N3O3/c17-12(14-10(13(18)19)7-5-6-7)11-8-3-1-2-4-9(8)15-16-11/h1-4,7,10H,5-6H2,(H,14,17)(H,15,16)(H,18,19) |
InChiKey: | InChIKey=CBRPUVPRGBTKKT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.