* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5871638 |
English Synonyms: | ABAMACHEM ABA-5871638 |
MDL Number.: | MFCD18010861 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | Cc1cc(no1)NC(=O)CNC(C2CC2)C(=O)O |
InChi: | InChI=1S/C11H15N3O4/c1-6-4-8(14-18-6)13-9(15)5-12-10(11(16)17)7-2-3-7/h4,7,10,12H,2-3,5H2,1H3,(H,16,17)(H,13,14,15) |
InChiKey: | InChIKey=HRDQKZHWMDQQIV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.