* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5871642 |
| English Synonyms: | ABAMACHEM ABA-5871642 |
| MDL Number.: | MFCD18010865 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | C1CCC2C(C1)CC(N2)C(=O)NC(C3CC3)C(=O)O |
| InChi: | InChI=1S/C14H22N2O3/c17-13(16-12(14(18)19)8-5-6-8)11-7-9-3-1-2-4-10(9)15-11/h8-12,15H,1-7H2,(H,16,17)(H,18,19) |
| InChiKey: | InChIKey=ADTITTIOJDPXFE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.