* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(4-BROMO-2-METHYLPHENYL)-8-AZABICYCLO[3.2.1]OCTAN-3-ONE |
English Synonyms: | 8-(4-BROMO-2-METHYLPHENYL)-8-AZABICYCLO[3.2.1]OCTAN-3-ONE |
MDL Number.: | MFCD18012442 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | Cc1cc(ccc1N2C3CCC2CC(=O)C3)Br |
InChi: | InChI=1S/C14H16BrNO/c1-9-6-10(15)2-5-14(9)16-11-3-4-12(16)8-13(17)7-11/h2,5-6,11-12H,3-4,7-8H2,1H3 |
InChiKey: | InChIKey=NYNFNIDDUICUAO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.