* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5874218 |
| English Synonyms: | ABAMACHEM ABA-5874218 |
| MDL Number.: | MFCD18013416 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)C1CCC(CC1)C(Cc2[nH]ccn2)N |
| InChi: | InChI=1S/C15H27N3/c1-15(2,3)12-6-4-11(5-7-12)13(16)10-14-17-8-9-18-14/h8-9,11-13H,4-7,10,16H2,1-3H3,(H,17,18) |
| InChiKey: | InChIKey=AFFWDQOAOYERSJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.