* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5875926 |
| English Synonyms: | ABAMACHEM ABA-5875926 |
| MDL Number.: | MFCD18014540 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cn1ccnc1CCNc2c(nccn2)C#N |
| InChi: | InChI=1S/C11H12N6/c1-17-7-6-14-10(17)2-3-15-11-9(8-12)13-4-5-16-11/h4-7H,2-3H2,1H3,(H,15,16) |
| InChiKey: | InChIKey=ILHIVKIDIMHCMS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.