* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5876500 |
| English Synonyms: | ABAMACHEM ABA-5876500 |
| MDL Number.: | MFCD18015102 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCCCCCn1cc(cn1)C(C)NC |
| InChi: | InChI=1S/C14H27N3/c1-4-5-6-7-8-9-10-17-12-14(11-16-17)13(2)15-3/h11-13,15H,4-10H2,1-3H3 |
| InChiKey: | InChIKey=HVWFDZNUWBJRDF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.