* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(BUTAN-2-YL)-N-ETHYL-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-AMINE |
English Synonyms: | 8-(BUTAN-2-YL)-N-ETHYL-1,2,4,5-TETRAHYDRO-3-BENZOXEPIN-1-AMINE |
MDL Number.: | MFCD18015365 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCC(C)c1ccc2c(c1)C(COCC2)NCC |
InChi: | InChI=1S/C16H25NO/c1-4-12(3)14-7-6-13-8-9-18-11-16(17-5-2)15(13)10-14/h6-7,10,12,16-17H,4-5,8-9,11H2,1-3H3 |
InChiKey: | InChIKey=GAUDTVHLPISJQD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.