* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5876781 |
| English Synonyms: | ABAMACHEM ABA-5876781 |
| MDL Number.: | MFCD18015381 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1c2c(c3c(c1Cl)CCOCC3Cl)OCCCO2 |
| InChi: | InChI=1S/C13H14Cl2O3/c14-9-6-11-13(18-4-1-3-17-11)12-8(9)2-5-16-7-10(12)15/h6,10H,1-5,7H2 |
| InChiKey: | InChIKey=NEQCOAHIVDXZGK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.