* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5876808 |
English Synonyms: | ABAMACHEM ABA-5876808 |
MDL Number.: | MFCD18015408 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCn1ccnc1CSc2ccc(cc2F)N |
InChi: | InChI=1S/C12H14FN3S/c1-2-16-6-5-15-12(16)8-17-11-4-3-9(14)7-10(11)13/h3-7H,2,8,14H2,1H3 |
InChiKey: | InChIKey=GZHHVXVYPNFSGT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.