* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5877046 |
English Synonyms: | ABAMACHEM ABA-5877046 |
MDL Number.: | MFCD18015644 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCNCc1nnnn1Cc2ccccc2C |
InChi: | InChI=1S/C13H19N5/c1-3-8-14-9-13-15-16-17-18(13)10-12-7-5-4-6-11(12)2/h4-7,14H,3,8-10H2,1-2H3 |
InChiKey: | InChIKey=OGQYWZURBBCAGU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.