* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5877052 |
English Synonyms: | ABAMACHEM ABA-5877052 |
MDL Number.: | MFCD18015650 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCNCc1nnnn1CCC2CCCCC2 |
InChi: | InChI=1S/C12H23N5/c1-2-13-10-12-14-15-16-17(12)9-8-11-6-4-3-5-7-11/h11,13H,2-10H2,1H3 |
InChiKey: | InChIKey=BPDQWRNJRATKOP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.