* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5877055 |
English Synonyms: | ABAMACHEM ABA-5877055 |
MDL Number.: | MFCD18015653 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CCNCc1nnnn1CC2CCS(=O)(=O)C2 |
InChi: | InChI=1S/C9H17N5O2S/c1-2-10-5-9-11-12-13-14(9)6-8-3-4-17(15,16)7-8/h8,10H,2-7H2,1H3 |
InChiKey: | InChIKey=LNBITBDAYWKPIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.