* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5877066 |
| English Synonyms: | ABAMACHEM ABA-5877066 |
| MDL Number.: | MFCD18015664 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCNCc1nnnn1Cc2cccc(c2)Cl |
| InChi: | InChI=1S/C11H14ClN5/c1-2-13-7-11-14-15-16-17(11)8-9-4-3-5-10(12)6-9/h3-6,13H,2,7-8H2,1H3 |
| InChiKey: | InChIKey=INHWIPXKVZTIOJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.