* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5877081 |
English Synonyms: | ABAMACHEM ABA-5877081 |
MDL Number.: | MFCD18015679 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | COCCNCc1nnnn1CC2CCCCO2 |
InChi: | InChI=1S/C11H21N5O2/c1-17-7-5-12-8-11-13-14-15-16(11)9-10-4-2-3-6-18-10/h10,12H,2-9H2,1H3 |
InChiKey: | InChIKey=ZIIUTRFIVCELFZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.