* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5877360 |
| English Synonyms: | ABAMACHEM ABA-5877360 |
| MDL Number.: | MFCD18015957 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(CCc1ccco1)NCc2cnccn2 |
| InChi: | InChI=1S/C13H17N3O/c1-11(4-5-13-3-2-8-17-13)16-10-12-9-14-6-7-15-12/h2-3,6-9,11,16H,4-5,10H2,1H3 |
| InChiKey: | InChIKey=NDSQFDDTZFPZDI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.