* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5877616 |
English Synonyms: | ABAMACHEM ABA-5877616 |
MDL Number.: | MFCD18016213 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cn(cn1)CCCCNCc2cncnc2 |
InChi: | InChI=1S/C12H17N5/c1(2-5-17-6-4-14-11-17)3-13-7-12-8-15-10-16-9-12/h4,6,8-11,13H,1-3,5,7H2 |
InChiKey: | InChIKey=YSUDUZKSSDQTOD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.