* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5877638 |
| English Synonyms: | ABAMACHEM ABA-5877638 |
| MDL Number.: | MFCD18016235 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | c1cc(c(cc1C(=O)O)O)NC(=O)C2CCCOC2 |
| InChi: | InChI=1S/C13H15NO5/c15-11-6-8(13(17)18)3-4-10(11)14-12(16)9-2-1-5-19-7-9/h3-4,6,9,15H,1-2,5,7H2,(H,14,16)(H,17,18) |
| InChiKey: | InChIKey=NFCFYFPKSKXXGV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.