* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5878166 |
English Synonyms: | ABAMACHEM ABA-5878166 |
MDL Number.: | MFCD18016762 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COCCNCc1ccnc(n1)Cc2cccs2 |
InChi: | InChI=1S/C13H17N3OS/c1-17-7-6-14-10-11-4-5-15-13(16-11)9-12-3-2-8-18-12/h2-5,8,14H,6-7,9-10H2,1H3 |
InChiKey: | InChIKey=HDHJGSQCFFEYAM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.