* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5878444 |
English Synonyms: | ABAMACHEM ABA-5878444 |
MDL Number.: | MFCD18017038 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | Cc1[nH]cc(n1)CNc2ccc(cc2Br)S(=O)(=O)N |
InChi: | InChI=1S/C11H13BrN4O2S/c1-7-14-5-8(16-7)6-15-11-3-2-9(4-10(11)12)19(13,17)18/h2-5,15H,6H2,1H3,(H,14,16)(H2,13,17,18) |
InChiKey: | InChIKey=GGFOKXSUAOWQBX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.