* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5879227 |
English Synonyms: | ABAMACHEM ABA-5879227 |
MDL Number.: | MFCD18017812 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cn1cc(nn1)CNc2cc(c(cc2Cl)Cl)Cl |
InChi: | InChI=1S/C10H9Cl3N4/c1-17-5-6(15-16-17)4-14-10-3-8(12)7(11)2-9(10)13/h2-3,5,14H,4H2,1H3 |
InChiKey: | InChIKey=GUXUASRWNOWYJE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.