* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5879232 |
English Synonyms: | ABAMACHEM ABA-5879232 |
MDL Number.: | MFCD18017817 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1CCCCN1CCCNCc2cn(nn2)C |
InChi: | InChI=1S/C13H25N5/c1-12-6-3-4-8-18(12)9-5-7-14-10-13-11-17(2)16-15-13/h11-12,14H,3-10H2,1-2H3 |
InChiKey: | InChIKey=NHEFQXBUYVFZNL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.