* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5879234 |
| English Synonyms: | ABAMACHEM ABA-5879234 |
| MDL Number.: | MFCD18017819 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | Cn1cc(nn1)CNc2cccc(c2)S(=O)(=O)N |
| InChi: | InChI=1S/C10H13N5O2S/c1-15-7-9(13-14-15)6-12-8-3-2-4-10(5-8)18(11,16)17/h2-5,7,12H,6H2,1H3,(H2,11,16,17) |
| InChiKey: | InChIKey=QGQPSYUSNUFMPJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.