* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5879235 |
English Synonyms: | ABAMACHEM ABA-5879235 |
MDL Number.: | MFCD18017820 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cn1cc(nn1)CNc2ccc(cc2)S(=O)(=O)C |
InChi: | InChI=1S/C11H14N4O2S/c1-15-8-10(13-14-15)7-12-9-3-5-11(6-4-9)18(2,16)17/h3-6,8,12H,7H2,1-2H3 |
InChiKey: | InChIKey=IGUQBPBKVRWWHO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.