* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5879780 |
English Synonyms: | ABAMACHEM ABA-5879780 |
MDL Number.: | MFCD18018365 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCCNCc1cnc(s1)N2CCOCC2C |
InChi: | InChI=1S/C12H21N3OS/c1-3-4-13-7-11-8-14-12(17-11)15-5-6-16-9-10(15)2/h8,10,13H,3-7,9H2,1-2H3 |
InChiKey: | InChIKey=BFFDLGKXVMYJNZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.