* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5879784 |
English Synonyms: | ABAMACHEM ABA-5879784 |
MDL Number.: | MFCD18018369 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC1CN(CCO1)c2ncc(s2)CNC(C)(C)C |
InChi: | InChI=1S/C14H25N3OS/c1-5-11-10-17(6-7-18-11)13-15-8-12(19-13)9-16-14(2,3)4/h8,11,16H,5-7,9-10H2,1-4H3 |
InChiKey: | InChIKey=AMEYQGAWCSXTQP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.