* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5880635 |
English Synonyms: | ABAMACHEM ABA-5880635 |
MDL Number.: | MFCD18019209 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)c2cnn(c2)CC(=O)NCCO |
InChi: | InChI=1S/C13H15N3O2/c17-7-6-14-13(18)10-16-9-12(8-15-16)11-4-2-1-3-5-11/h1-5,8-9,17H,6-7,10H2,(H,14,18) |
InChiKey: | InChIKey=BUMBYRWELMNHQC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.