* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5883728 |
English Synonyms: | ABAMACHEM ABA-5883728 |
MDL Number.: | MFCD18022234 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CC(C)CCN1CCN(CC1)C(=O)c2nc([nH]n2)N |
InChi: | InChI=1S/C12H22N6O/c1-9(2)3-4-17-5-7-18(8-6-17)11(19)10-14-12(13)16-15-10/h9H,3-8H2,1-2H3,(H3,13,14,15,16) |
InChiKey: | InChIKey=DQZGAOBHYFDIGE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.