* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5883736 |
English Synonyms: | ABAMACHEM ABA-5883736 |
MDL Number.: | MFCD18022242 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | CCC(C)NC(=O)CCNC(=O)c1nc([nH]n1)N |
InChi: | InChI=1S/C10H18N6O2/c1-3-6(2)13-7(17)4-5-12-9(18)8-14-10(11)16-15-8/h6H,3-5H2,1-2H3,(H,12,18)(H,13,17)(H3,11,14,15,16) |
InChiKey: | InChIKey=HFSHXHRBDXQUTN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.