* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5883742 |
English Synonyms: | ABAMACHEM ABA-5883742 |
MDL Number.: | MFCD18022248 |
H bond acceptor: | 9 |
H bond donor: | 2 |
Smile: | COC(=O)N1CCN(CC1)C(=O)c2nc([nH]n2)N |
InChi: | InChI=1S/C9H14N6O3/c1-18-9(17)15-4-2-14(3-5-15)7(16)6-11-8(10)13-12-6/h2-5H2,1H3,(H3,10,11,12,13) |
InChiKey: | InChIKey=VOUANZMBARMLGP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.