* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5883749 |
| English Synonyms: | ABAMACHEM ABA-5883749 |
| MDL Number.: | MFCD18022255 |
| H bond acceptor: | 10 |
| H bond donor: | 4 |
| Smile: | CS(=O)(=O)CCC(C(=O)O)NC(=O)c1nc([nH]n1)N |
| InChi: | InChI=1S/C8H13N5O5S/c1-19(17,18)3-2-4(7(15)16)10-6(14)5-11-8(9)13-12-5/h4H,2-3H2,1H3,(H,10,14)(H,15,16)(H3,9,11,12,13) |
| InChiKey: | InChIKey=OYLYFSOWSPPBTD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.