* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5883755 |
| English Synonyms: | ABAMACHEM ABA-5883755 |
| MDL Number.: | MFCD18022261 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | CC(C)N(CCCC(=O)O)C(=O)c1nc([nH]n1)N |
| InChi: | InChI=1S/C10H17N5O3/c1-6(2)15(5-3-4-7(16)17)9(18)8-12-10(11)14-13-8/h6H,3-5H2,1-2H3,(H,16,17)(H3,11,12,13,14) |
| InChiKey: | InChIKey=DPSVDPHWGBOPSV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.