* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5883758 |
English Synonyms: | ABAMACHEM ABA-5883758 |
MDL Number.: | MFCD18022264 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | CC(C)C[C@@H](C(=O)O)NC(=O)c1nc([nH]n1)N |
InChi: | InChI=1S/C9H15N5O3/c1-4(2)3-5(8(16)17)11-7(15)6-12-9(10)14-13-6/h4-5H,3H2,1-2H3,(H,11,15)(H,16,17)(H3,10,12,13,14)/t5-/m0/s1 |
InChiKey: | InChIKey=MUEVUCFTQKFXHP-YFKPBYRVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.