* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5883772 |
English Synonyms: | ABAMACHEM ABA-5883772 |
MDL Number.: | MFCD18022278 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CN(CCNC(=O)c1nc([nH]n1)N)c2ccccc2 |
InChi: | InChI=1S/C12H16N6O/c1-18(9-5-3-2-4-6-9)8-7-14-11(19)10-15-12(13)17-16-10/h2-6H,7-8H2,1H3,(H,14,19)(H3,13,15,16,17) |
InChiKey: | InChIKey=PRDGPMQYDRURKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.