* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5883990 |
English Synonyms: | ABAMACHEM ABA-5883990 |
MDL Number.: | MFCD18022494 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCOC(=O)C(C)NC(=O)c1c(nc(s1)N)C |
InChi: | InChI=1S/C10H15N3O3S/c1-4-16-9(15)6(3)12-8(14)7-5(2)13-10(11)17-7/h6H,4H2,1-3H3,(H2,11,13)(H,12,14) |
InChiKey: | InChIKey=USUZQLBKIGPDCE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.